C10H16N2O3 — CID 170828157
3-amino-1-(6-ethoxy-3-pyridinyl)propane-1,2-diol (PubChem CID 170828157) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-amino-1-(6-ethoxy-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(6-ethoxy-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828157 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-amino-1-(6-ethoxy-3-pyridinyl)propane-1,2-diol |
| SMILES | CCOc1ccc(C(O)C(O)CN)cn1 |
| InChI | InChI=1S/C10H16N2O3/c1-2-15-9-4-3-7(6-12-9)10(14)8(13)5-11/h3-4,6,8,10,13-14H,2,5,11H2,1H3 |
| InChIKey | CJEXXABXKYIRLW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |