C11H17NO4 — CID 171872420
1-(6-ethoxy-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872420) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(6-ethoxy-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(6-ethoxy-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872420 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(6-ethoxy-3-pyridinyl)butane-1,2,4-triol |
| SMILES | CCOc1ccc(C(O)C(O)CCO)cn1 |
| InChI | InChI=1S/C11H17NO4/c1-2-16-10-4-3-8(7-12-10)11(15)9(14)5-6-13/h3-4,7,9,11,13-15H,2,5-6H2,1H3 |
| InChIKey | ZJHQMHIEODOAER-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |