C10H14BrNO3 — CID 171891786
4-bromo-1-(6-methoxy-3-pyridinyl)butane-1,2-diol (PubChem CID 171891786) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 4-bromo-1-(6-methoxy-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(6-methoxy-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891786 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 4-bromo-1-(6-methoxy-3-pyridinyl)butane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CCBr)cn1 |
| InChI | InChI=1S/C10H14BrNO3/c1-15-9-3-2-7(6-12-9)10(14)8(13)4-5-11/h2-3,6,8,10,13-14H,4-5H2,1H3 |
| InChIKey | NYTQUAAQFGJYDR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|