C12H17BrO4 — CID 171892304
4-bromo-1-(3,5-dimethoxyphenyl)butane-1,2-diol (PubChem CID 171892304) has the molecular formula C12H17BrO4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 4-bromo-1-(3,5-dimethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(3,5-dimethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171892304 |
| Molecular Formula | C12H17BrO4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-bromo-1-(3,5-dimethoxyphenyl)butane-1,2-diol |
| SMILES | COc1cc(OC)cc(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C12H17BrO4/c1-16-9-5-8(6-10(7-9)17-2)12(15)11(14)3-4-13/h5-7,11-12,14-15H,3-4H2,1-2H3 |
| InChIKey | GESARVKXIFBVJY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|