C15H24O4 — CID 103459693
1-(3,5-dimethoxyphenyl)-3-ethylpentane-1,2-diol (PubChem CID 103459693) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 103459693 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C15H24O4/c1-5-10(6-2)14(16)15(17)11-7-12(18-3)9-13(8-11)19-4/h7-10,14-17H,5-6H2,1-4H3 |
| InChIKey | JERGPXMBLFQDRD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |