C11H13NO4 — CID 171870525
3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870525) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870525 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | COc1cc(OC)cc(C(O)C(O)C#N)c1 |
| InChI | InChI=1S/C11H13NO4/c1-15-8-3-7(4-9(5-8)16-2)11(14)10(13)6-12/h3-5,10-11,13-14H,1-2H3 |
| InChIKey | CIZTWSYTUHBZBW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|