C10H11NO4 — CID 171870100
2,3-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)propanenitrile (PubChem CID 171870100) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 171870100 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2,3-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)propanenitrile |
| SMILES | COc1ccc(C(O)C(O)C#N)cc1O |
| InChI | InChI=1S/C10H11NO4/c1-15-9-3-2-6(4-7(9)12)10(14)8(13)5-11/h2-4,8,10,12-14H,1H3 |
| InChIKey | FYWPBXDAQPRBKV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|