C9H8BrNO3 — CID 171871320
3-(3-bromo-4-hydroxyphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171871320) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxyphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(3-bromo-4-hydroxyphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871320 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 3-(3-bromo-4-hydroxyphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C9H8BrNO3/c10-6-3-5(1-2-7(6)12)9(14)8(13)4-11/h1-3,8-9,12-14H |
| InChIKey | SGJPBZUYMQLQOB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|