C9H8ClNO3 — CID 171869831
3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869831) has the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869831 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C9H8ClNO3/c10-5-1-2-7(12)6(3-5)9(14)8(13)4-11/h1-3,8-9,12-14H |
| InChIKey | RVQFOQSTURXSEO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|