C8H7ClN2O3 — CID 171869996
3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanenitrile (PubChem CID 171869996) has the molecular formula C8H7ClN2O3 and a molecular weight of 214.61 g/mol. Its IUPAC name is 3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869996 |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C8H7ClN2O3/c9-4-1-5(8(14)11-3-4)7(13)6(12)2-10/h1,3,6-7,12-13H,(H,11,14) |
| InChIKey | HAZNWMHAUDMLFQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|