C8H11ClN2O2 — CID 131029233
5-chloro-3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one (PubChem CID 131029233) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 5-chloro-3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one.
| Compound Name | 5-chloro-3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 131029233 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 5-chloro-3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one |
| SMILES | CN[C@H](CO)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C8H11ClN2O2/c1-10-7(4-12)6-2-5(9)3-11-8(6)13/h2-3,7,10,12H,4H2,1H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | VTZVRRIJBXMBCT-SSDOTTSWSA-N |
| XLogP | 0.28 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |