C8H8ClNO2 — CID 169453100
5-chloro-3-(3-hydroxyprop-1-enyl)-1H-pyridin-2-one (PubChem CID 169453100) has the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. Its IUPAC name is 5-chloro-3-(3-hydroxyprop-1-enyl)-1H-pyridin-2-one.
| Compound Name | 5-chloro-3-(3-hydroxyprop-1-enyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169453100 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | 5-chloro-3-(3-hydroxyprop-1-enyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(Cl)cc1C=CCO |
| InChI | InChI=1S/C8H8ClNO2/c9-7-4-6(2-1-3-11)8(12)10-5-7/h1-2,4-5,11H,3H2,(H,10,12) |
| InChIKey | UBYYALATMAUGNJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |