C9H8Cl2O2 — CID 169453261
2,5-dichloro-4-(3-hydroxyprop-1-enyl)phenol (PubChem CID 169453261) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 2,5-dichloro-4-(3-hydroxyprop-1-enyl)phenol.
| Compound Name | 2,5-dichloro-4-(3-hydroxyprop-1-enyl)phenol |
|---|---|
| PubChem CID | 169453261 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2,5-dichloro-4-(3-hydroxyprop-1-enyl)phenol |
| SMILES | OCC=Cc1cc(Cl)c(O)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c10-7-5-9(13)8(11)4-6(7)2-1-3-12/h1-2,4-5,12-13H,3H2 |
| InChIKey | FUIHMLHQDHAIDQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |