C9H10O3 — CID 18539716
4-[(E)-3-hydroxyprop-1-enyl]benzene-1,3-diol (PubChem CID 18539716) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-[(E)-3-hydroxyprop-1-enyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-3-hydroxyprop-1-enyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 18539716 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-[(E)-3-hydroxyprop-1-enyl]benzene-1,3-diol |
| SMILES | OC/C=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C9H10O3/c10-5-1-2-7-3-4-8(11)6-9(7)12/h1-4,6,10-12H,5H2/b2-1+ |
| InChIKey | DNAFPMHFCCWACS-OWOJBTEDSA-N |
| XLogP | 1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |