C10H13NO2 — CID 170486543
4-(4-aminobut-1-enyl)benzene-1,3-diol (PubChem CID 170486543) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(4-aminobut-1-enyl)benzene-1,3-diol.
| Compound Name | 4-(4-aminobut-1-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 170486543 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(4-aminobut-1-enyl)benzene-1,3-diol |
| SMILES | NCCC=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C10H13NO2/c11-6-2-1-3-8-4-5-9(12)7-10(8)13/h1,3-5,7,12-13H,2,6,11H2 |
| InChIKey | FBLICESWFWAYFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |