C18H19NO4 — CID 170493606
benzyl N-[4-(2,4-dihydroxyphenyl)but-3-enyl]carbamate (PubChem CID 170493606) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl N-[4-(2,4-dihydroxyphenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(2,4-dihydroxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493606 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | benzyl N-[4-(2,4-dihydroxyphenyl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ccc(O)cc1O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c20-16-10-9-15(17(21)12-16)8-4-5-11-19-18(22)23-13-14-6-2-1-3-7-14/h1-4,6-10,12,20-21H,5,11,13H2,(H,19,22) |
| InChIKey | DOFMFOUTKRSYEQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|