C18H18FNO4S — CID 170494331
benzyl N-[4-(2-fluorosulfonylphenyl)but-3-enyl]carbamate (PubChem CID 170494331) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is benzyl N-[4-(2-fluorosulfonylphenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluorosulfonylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494331 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | benzyl N-[4-(2-fluorosulfonylphenyl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ccccc1S(=O)(=O)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18FNO4S/c19-25(22,23)17-12-5-4-10-16(17)11-6-7-13-20-18(21)24-14-15-8-2-1-3-9-15/h1-6,8-12H,7,13-14H2,(H,20,21) |
| InChIKey | UDLGVSIDTQCTBG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|