C18H17ClFNO2 — CID 170493581
benzyl N-[4-(2-chloro-4-fluorophenyl)but-3-enyl]carbamate (PubChem CID 170493581) has the molecular formula C18H17ClFNO2 and a molecular weight of 333.79 g/mol. Its IUPAC name is benzyl N-[4-(2-chloro-4-fluorophenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(2-chloro-4-fluorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493581 |
| Molecular Formula | C18H17ClFNO2 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | benzyl N-[4-(2-chloro-4-fluorophenyl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ccc(F)cc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C18H17ClFNO2/c19-17-12-16(20)10-9-15(17)8-4-5-11-21-18(22)23-13-14-6-2-1-3-7-14/h1-4,6-10,12H,5,11,13H2,(H,21,22) |
| InChIKey | APOSICFGAMBGLH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|