C19H21FN2O2 — CID 170494025
benzyl N-[4-[2-(aminomethyl)-5-fluorophenyl]but-3-enyl]carbamate (PubChem CID 170494025) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is benzyl N-[4-[2-(aminomethyl)-5-fluorophenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[2-(aminomethyl)-5-fluorophenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494025 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | benzyl N-[4-[2-(aminomethyl)-5-fluorophenyl]but-3-enyl]carbamate |
| SMILES | NCc1ccc(F)cc1C=CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21FN2O2/c20-18-10-9-17(13-21)16(12-18)8-4-5-11-22-19(23)24-14-15-6-2-1-3-7-15/h1-4,6-10,12H,5,11,13-14,21H2,(H,22,23) |
| InChIKey | BGFXCJNXGJJDOS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|