C19H17F2NO4 — CID 170494597
4,5-difluoro-2-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoic acid (PubChem CID 170494597) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is 4,5-difluoro-2-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoic acid.
| Compound Name | 4,5-difluoro-2-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170494597 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4,5-difluoro-2-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoic acid |
| SMILES | O=C(NCCC=Cc1cc(F)c(F)cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H17F2NO4/c20-16-10-14(15(18(23)24)11-17(16)21)8-4-5-9-22-19(25)26-12-13-6-2-1-3-7-13/h1-4,6-8,10-11H,5,9,12H2,(H,22,25)(H,23,24) |
| InChIKey | REJPSPGINAWETE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|