C18H19ClN2O2 — CID 170493708
benzyl N-[4-(5-amino-2-chlorophenyl)but-3-enyl]carbamate (PubChem CID 170493708) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is benzyl N-[4-(5-amino-2-chlorophenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(5-amino-2-chlorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493708 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | benzyl N-[4-(5-amino-2-chlorophenyl)but-3-enyl]carbamate |
| SMILES | Nc1ccc(Cl)c(C=CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19ClN2O2/c19-17-10-9-16(20)12-15(17)8-4-5-11-21-18(22)23-13-14-6-2-1-3-7-14/h1-4,6-10,12H,5,11,13,20H2,(H,21,22) |
| InChIKey | XAHMPCCVZILEHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|