C17H16Cl2N2O2 — CID 170493768
benzyl N-[4-(2,5-dichloro-3-pyridinyl)but-3-enyl]carbamate (PubChem CID 170493768) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is benzyl N-[4-(2,5-dichloro-3-pyridinyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(2,5-dichloro-3-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493768 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | benzyl N-[4-(2,5-dichloro-3-pyridinyl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cc(Cl)cnc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-15-10-14(16(19)21-11-15)8-4-5-9-20-17(22)23-12-13-6-2-1-3-7-13/h1-4,6-8,10-11H,5,9,12H2,(H,20,22) |
| InChIKey | ZBUNDMCNYQZPBZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|