C17H18N2O4S — CID 169472018
benzyl N-[3-(2-sulfamoylphenyl)prop-2-enyl]carbamate (PubChem CID 169472018) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is benzyl N-[3-(2-sulfamoylphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-sulfamoylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472018 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | benzyl N-[3-(2-sulfamoylphenyl)prop-2-enyl]carbamate |
| SMILES | NS(=O)(=O)c1ccccc1C=CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c18-24(21,22)16-11-5-4-9-15(16)10-6-12-19-17(20)23-13-14-7-2-1-3-8-14/h1-11H,12-13H2,(H,19,20)(H2,18,21,22) |
| InChIKey | YTAHNLMZFCKLTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |