C19H19NO5 — CID 169472193
methyl 4-hydroxy-3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoate (PubChem CID 169472193) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 4-hydroxy-3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoate.
| Compound Name | methyl 4-hydroxy-3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 169472193 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 4-hydroxy-3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(O)c(C=CCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO5/c1-24-18(22)16-9-10-17(21)15(12-16)8-5-11-20-19(23)25-13-14-6-3-2-4-7-14/h2-10,12,21H,11,13H2,1H3,(H,20,23) |
| InChIKey | MEEKZFAPIDRCLF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |