C19H22N2O2 — CID 169471640
benzyl N-[3-(4-amino-2,5-dimethylphenyl)prop-2-enyl]carbamate (PubChem CID 169471640) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is benzyl N-[3-(4-amino-2,5-dimethylphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-amino-2,5-dimethylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471640 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | benzyl N-[3-(4-amino-2,5-dimethylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C=CCNC(=O)OCc2ccccc2)c(C)cc1N |
| InChI | InChI=1S/C19H22N2O2/c1-14-12-18(20)15(2)11-17(14)9-6-10-21-19(22)23-13-16-7-4-3-5-8-16/h3-9,11-12H,10,13,20H2,1-2H3,(H,21,22) |
| InChIKey | HMQUQFRLCOUBID-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|