C23H24N2O2 — CID 169472972
benzyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enyl]carbamate (PubChem CID 169472972) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is benzyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472972 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | benzyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C=CCNC(=O)OCc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-18-16-21(19(2)25(18)22-13-7-4-8-14-22)12-9-15-24-23(26)27-17-20-10-5-3-6-11-20/h3-14,16H,15,17H2,1-2H3,(H,24,26) |
| InChIKey | QZTAAHRJODXGGH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|