C18H19NO3 — CID 169471204
benzyl N-[3-[2-(hydroxymethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169471204) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is benzyl N-[3-[2-(hydroxymethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[2-(hydroxymethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471204 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | benzyl N-[3-[2-(hydroxymethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccccc1CO)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c20-13-17-10-5-4-9-16(17)11-6-12-19-18(21)22-14-15-7-2-1-3-8-15/h1-11,20H,12-14H2,(H,19,21) |
| InChIKey | LGBMPTXQUIBHFQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |