C18H18FNO3 — CID 169471497
benzyl N-[3-[2-fluoro-4-(hydroxymethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169471497) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is benzyl N-[3-[2-fluoro-4-(hydroxymethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[2-fluoro-4-(hydroxymethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471497 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | benzyl N-[3-[2-fluoro-4-(hydroxymethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(CO)cc1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18FNO3/c19-17-11-15(12-21)8-9-16(17)7-4-10-20-18(22)23-13-14-5-2-1-3-6-14/h1-9,11,21H,10,12-13H2,(H,20,22) |
| InChIKey | NHGLOGJZKRPZKL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |