C18H16ClNO4 — CID 169471866
5-chloro-2-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid (PubChem CID 169471866) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is 5-chloro-2-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid.
| Compound Name | 5-chloro-2-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 169471866 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-chloro-2-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid |
| SMILES | O=C(NCC=Cc1ccc(Cl)cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16ClNO4/c19-15-9-8-14(16(11-15)17(21)22)7-4-10-20-18(23)24-12-13-5-2-1-3-6-13/h1-9,11H,10,12H2,(H,20,23)(H,21,22) |
| InChIKey | JJPNXNTUTZFDHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |