C17H17ClN2O3 — CID 169471693
benzyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)prop-2-enyl]carbamate (PubChem CID 169471693) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is benzyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471693 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | benzyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)prop-2-enyl]carbamate |
| SMILES | Nc1cc(Cl)cc(C=CCNC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C17H17ClN2O3/c18-14-9-13(16(21)15(19)10-14)7-4-8-20-17(22)23-11-12-5-2-1-3-6-12/h1-7,9-10,21H,8,11,19H2,(H,20,22) |
| InChIKey | JFRGUIGADSKXJP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|