C16H15ClN2O2 — CID 169471067
benzyl N-[3-(3-chloro-4-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169471067) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is benzyl N-[3-(3-chloro-4-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-chloro-4-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471067 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | benzyl N-[3-(3-chloro-4-pyridinyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccncc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O2/c17-15-11-18-10-8-14(15)7-4-9-19-16(20)21-12-13-5-2-1-3-6-13/h1-8,10-11H,9,12H2,(H,19,20) |
| InChIKey | XCGHPLJWOPSRFT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |