C15H15N3O2 — CID 169470986
benzyl N-(3-pyrimidin-5-ylprop-2-enyl)carbamate (PubChem CID 169470986) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is benzyl N-(3-pyrimidin-5-ylprop-2-enyl)carbamate.
| Compound Name | benzyl N-(3-pyrimidin-5-ylprop-2-enyl)carbamate |
|---|---|
| PubChem CID | 169470986 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | benzyl N-(3-pyrimidin-5-ylprop-2-enyl)carbamate |
| SMILES | O=C(NCC=Cc1cncnc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H15N3O2/c19-15(20-11-13-5-2-1-3-6-13)18-8-4-7-14-9-16-12-17-10-14/h1-7,9-10,12H,8,11H2,(H,18,19) |
| InChIKey | ROEHXOFWTCMGFV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |