C15H13Cl2N3O2 — CID 169471267
benzyl N-[3-(2,4-dichloropyrimidin-5-yl)prop-2-enyl]carbamate (PubChem CID 169471267) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is benzyl N-[3-(2,4-dichloropyrimidin-5-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2,4-dichloropyrimidin-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471267 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | benzyl N-[3-(2,4-dichloropyrimidin-5-yl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cnc(Cl)nc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C15H13Cl2N3O2/c16-13-12(9-19-14(17)20-13)7-4-8-18-15(21)22-10-11-5-2-1-3-6-11/h1-7,9H,8,10H2,(H,18,21) |
| InChIKey | KKXZMUXNSDGRCQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |