C17H19N3O2 — CID 169471246
benzyl N-[3-(2-amino-5-methyl-3-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169471246) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is benzyl N-[3-(2-amino-5-methyl-3-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-amino-5-methyl-3-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471246 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | benzyl N-[3-(2-amino-5-methyl-3-pyridinyl)prop-2-enyl]carbamate |
| SMILES | Cc1cnc(N)c(C=CCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-10-15(16(18)20-11-13)8-5-9-19-17(21)22-12-14-6-3-2-4-7-14/h2-8,10-11H,9,12H2,1H3,(H2,18,20)(H,19,21) |
| InChIKey | OBDMFYNHZIYGDS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |