C19H21N3O4 — CID 170494649
methyl 6-amino-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]pyridine-3-carboxylate (PubChem CID 170494649) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 6-amino-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-amino-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170494649 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 6-amino-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N)c(C=CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-25-18(23)16-11-15(17(20)22-12-16)9-5-6-10-21-19(24)26-13-14-7-3-2-4-8-14/h2-5,7-9,11-12H,6,10,13H2,1H3,(H2,20,22)(H,21,24) |
| InChIKey | ATELDUCHJZXRIP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|