C18H22N4O2 — CID 170494153
benzyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-enyl]carbamate (PubChem CID 170494153) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is benzyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494153 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | benzyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-enyl]carbamate |
| SMILES | CN(C)c1ncc(C=CCCNC(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C18H22N4O2/c1-22(2)17-20-12-16(13-21-17)10-6-7-11-19-18(23)24-14-15-8-4-3-5-9-15/h3-6,8-10,12-13H,7,11,14H2,1-2H3,(H,19,23) |
| InChIKey | HTEPQNVCYNMZDF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|