C21H27NO2Si — CID 170494266
benzyl N-[4-(3-trimethylsilylphenyl)but-3-enyl]carbamate (PubChem CID 170494266) has the molecular formula C21H27NO2Si and a molecular weight of 353.54 g/mol. Its IUPAC name is benzyl N-[4-(3-trimethylsilylphenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(3-trimethylsilylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494266 |
| Molecular Formula | C21H27NO2Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | benzyl N-[4-(3-trimethylsilylphenyl)but-3-enyl]carbamate |
| SMILES | C[Si](C)(C)c1cccc(C=CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H27NO2Si/c1-25(2,3)20-14-9-13-18(16-20)10-7-8-15-22-21(23)24-17-19-11-5-4-6-12-19/h4-7,9-14,16H,8,15,17H2,1-3H3,(H,22,23) |
| InChIKey | JUIDUUHKXFAVJC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|