C17H21N3O2 — CID 170493464
benzyl N-[4-(1-ethylpyrazol-4-yl)but-3-enyl]carbamate (PubChem CID 170493464) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is benzyl N-[4-(1-ethylpyrazol-4-yl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(1-ethylpyrazol-4-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493464 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | benzyl N-[4-(1-ethylpyrazol-4-yl)but-3-enyl]carbamate |
| SMILES | CCn1cc(C=CCCNC(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C17H21N3O2/c1-2-20-13-16(12-19-20)10-6-7-11-18-17(21)22-14-15-8-4-3-5-9-15/h3-6,8-10,12-13H,2,7,11,14H2,1H3,(H,18,21) |
| InChIKey | YEFFGLLPCCVXTH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|