C18H18N2O3 — CID 170493789
benzyl N-[4-(6-formyl-3-pyridinyl)but-3-enyl]carbamate (PubChem CID 170493789) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is benzyl N-[4-(6-formyl-3-pyridinyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(6-formyl-3-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493789 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | benzyl N-[4-(6-formyl-3-pyridinyl)but-3-enyl]carbamate |
| SMILES | O=Cc1ccc(C=CCCNC(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C18H18N2O3/c21-13-17-10-9-15(12-20-17)6-4-5-11-19-18(22)23-14-16-7-2-1-3-8-16/h1-4,6-10,12-13H,5,11,14H2,(H,19,22) |
| InChIKey | NEEDSADZSSAATL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|