C9H10O2S — CID 169454721
4-(3-sulfanylprop-1-enyl)benzene-1,3-diol (PubChem CID 169454721) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-(3-sulfanylprop-1-enyl)benzene-1,3-diol.
| Compound Name | 4-(3-sulfanylprop-1-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 169454721 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 4-(3-sulfanylprop-1-enyl)benzene-1,3-diol |
| SMILES | Oc1ccc(C=CCS)c(O)c1 |
| InChI | InChI=1S/C9H10O2S/c10-8-4-3-7(2-1-5-12)9(11)6-8/h1-4,6,10-12H,5H2 |
| InChIKey | XTTZHZSLBZCMRX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|