C14H12O3 — CID 54100227
4-[2-(3-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 54100227) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-[2-(3-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 4-[2-(3-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 54100227 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-[2-(3-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1cccc(C=Cc2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C14H12O3/c15-12-3-1-2-10(8-12)4-5-11-6-7-13(16)9-14(11)17/h1-9,15-17H |
| InChIKey | NAAOQSKJMNPWMU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|