C14H12O4 — CID 173498744
3-[2-(3-hydroxyphenyl)ethenyl]benzene-1,2,4-triol (PubChem CID 173498744) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[2-(3-hydroxyphenyl)ethenyl]benzene-1,2,4-triol.
| Compound Name | 3-[2-(3-hydroxyphenyl)ethenyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 173498744 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[2-(3-hydroxyphenyl)ethenyl]benzene-1,2,4-triol |
| SMILES | Oc1cccc(C=Cc2c(O)ccc(O)c2O)c1 |
| InChI | InChI=1S/C14H12O4/c15-10-3-1-2-9(8-10)4-5-11-12(16)6-7-13(17)14(11)18/h1-8,15-18H |
| InChIKey | OMWOWIMBICQCHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|