About 4-(2,4-dihydroxyphenyl)but-3-enoic acid
4-(2,4-dihydroxyphenyl)but-3-enoic acid (PubChem CID 170483156) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)but-3-enoic acid.
Molecular Properties
| Compound Name | 4-(2,4-dihydroxyphenyl)but-3-enoic acid |
| PubChem CID | 170483156 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C10H10O4/c11-8-5-4-7(9(12)6-8)2-1-3-10(13)14/h1-2,4-6,11-12H,3H2,(H,13,14) |
| InChIKey | UNBXWCUQGJQCGD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dihydroxyphenyl)but-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dihydroxyphenyl)but-3-enoic acid?
The IUPAC name of 4-(2,4-dihydroxyphenyl)but-3-enoic acid (CID 170483156) is 4-(2,4-dihydroxyphenyl)but-3-enoic acid.
What is the SMILES notation for 4-(2,4-dihydroxyphenyl)but-3-enoic acid?
The canonical SMILES for 4-(2,4-dihydroxyphenyl)but-3-enoic acid is O=C(O)CC=Cc1ccc(O)cc1O.
What is the InChIKey of 4-(2,4-dihydroxyphenyl)but-3-enoic acid?
The InChIKey is UNBXWCUQGJQCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c11-8-5-4-7(9(12)6-8)2-1-3-10(13)14/h1-2,4-6,11-12H,3H2,(H,13,14).
What are the key properties of 4-(2,4-dihydroxyphenyl)but-3-enoic acid?
4-(2,4-dihydroxyphenyl)but-3-enoic acid has a molecular weight of 194.19 g/mol, XLogP of 1.59, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dihydroxyphenyl)but-3-enoic acid is sourced from PubChem (CID 170483156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).