2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid

C10H8O6 — CID 45093805

IUPAC2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid
SMILESO=C(O)C(=Cc1ccc(O)cc1O)C(=O)O
InChIInChI=1S/C10H8O6/c11-6-2-1-5(8(12)4-6)3-7(9(13)14)10(15)16/h1-4,11-12H,(H,13,14)(H,15,16)
InChIKeyYEBVKVWWFIGSOZ-UHFFFAOYSA-N
MW224.17 g/mol
LogP0.65
Rot. Bonds3

About 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid

2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid (PubChem CID 45093805) has the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid.

Molecular Properties

Compound Name2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid
PubChem CID45093805
Molecular FormulaC10H8O6
Molecular Weight224.17 g/mol
Exact Mass224.03
IUPAC Name2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid
SMILESO=C(O)C(=Cc1ccc(O)cc1O)C(=O)O
InChIInChI=1S/C10H8O6/c11-6-2-1-5(8(12)4-6)3-7(9(13)14)10(15)16/h1-4,11-12H,(H,13,14)(H,15,16)
InChIKeyYEBVKVWWFIGSOZ-UHFFFAOYSA-N
XLogP0.65
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.17
LogP ≤ 50.65
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}

Analyze 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid?
The IUPAC name of 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid (CID 45093805) is 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid.
What is the SMILES notation for 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid?
The canonical SMILES for 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid is O=C(O)C(=Cc1ccc(O)cc1O)C(=O)O.
What is the InChIKey of 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid?
The InChIKey is YEBVKVWWFIGSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O6/c11-6-2-1-5(8(12)4-6)3-7(9(13)14)10(15)16/h1-4,11-12H,(H,13,14)(H,15,16).
What are the key properties of 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid?
2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid has a molecular weight of 224.17 g/mol, XLogP of 0.65, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid is sourced from PubChem (CID 45093805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).