C10H8O6 — CID 45093805
2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid (PubChem CID 45093805) has the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid.
| Compound Name | 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 45093805 |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)methylidene]propanedioic acid |
| SMILES | O=C(O)C(=Cc1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C10H8O6/c11-6-2-1-5(8(12)4-6)3-7(9(13)14)10(15)16/h1-4,11-12H,(H,13,14)(H,15,16) |
| InChIKey | YEBVKVWWFIGSOZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|