C16H15N3O4 — CID 7137566
N-[(E)-1-(2,4-dihydroxyphenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 7137566) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dihydroxyphenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dihydroxyphenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 7137566 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(E)-1-(2,4-dihydroxyphenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | NNC(=O)/C(=C\c1ccc(O)cc1O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O4/c17-19-16(23)13(8-11-6-7-12(20)9-14(11)21)18-15(22)10-4-2-1-3-5-10/h1-9,20-21H,17H2,(H,18,22)(H,19,23)/b13-8+ |
| InChIKey | HLKOFUSDOVWZQP-MDWZMJQESA-N |
| XLogP | 0.86 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|