C25H23N3O5S — CID 22784480
N-[(Z)-3-[4-(2-amino-2-oxoethyl)sulfanylanilino]-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22784480) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[(Z)-3-[4-(2-amino-2-oxoethyl)sulfanylanilino]-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(2-amino-2-oxoethyl)sulfanylanilino]-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784480 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[(Z)-3-[4-(2-amino-2-oxoethyl)sulfanylanilino]-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(O)ccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCC(N)=O)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-33-22-14-19(29)10-7-17(22)13-21(28-24(31)16-5-3-2-4-6-16)25(32)27-18-8-11-20(12-9-18)34-15-23(26)30/h2-14,29H,15H2,1H3,(H2,26,30)(H,27,32)(H,28,31)/b21-13- |
| InChIKey | RDCRYEALXSGYNQ-BKUYFWCQSA-N |
| XLogP | 3.39 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|