C33H29N3O7S — CID 19315506
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 19315506) has the molecular formula C33H29N3O7S and a molecular weight of 611.68 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19315506 |
| Molecular Formula | C33H29N3O7S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2ccc(O)cc2OC)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H29N3O7S/c1-42-29-19-24(37)16-15-22(29)17-28(36-31(39)21-9-4-3-5-10-21)32(40)34-23-11-8-12-25(18-23)44-20-30(38)35-27-14-7-6-13-26(27)33(41)43-2/h3-19,37H,20H2,1-2H3,(H,34,40)(H,35,38)(H,36,39)/b28-17+ |
| InChIKey | JILFNLXCMBQXAJ-OGLMXYFKSA-N |
| XLogP | 5.33 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|