C30H26N2O4S — CID 22784485
N-[(Z)-3-(4-benzylsulfanylanilino)-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22784485) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[(Z)-3-(4-benzylsulfanylanilino)-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(4-benzylsulfanylanilino)-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784485 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-[(Z)-3-(4-benzylsulfanylanilino)-1-(4-hydroxy-2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(O)ccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N2O4S/c1-36-28-19-25(33)15-12-23(28)18-27(32-29(34)22-10-6-3-7-11-22)30(35)31-24-13-16-26(17-14-24)37-20-21-8-4-2-5-9-21/h2-19,33H,20H2,1H3,(H,31,35)(H,32,34)/b27-18- |
| InChIKey | AADRXDDAACFGEN-IMRQLAEWSA-N |
| XLogP | 6.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|