C21H22N2O3 — CID 3132884
N-[1-(2-hydroxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide (PubChem CID 3132884) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3132884 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NC(=Cc1ccccc1O)C(=O)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c24-19-12-6-5-11-17(19)15-18(21(26)23-13-7-2-8-14-23)22-20(25)16-9-3-1-4-10-16/h1,3-6,9-12,15,24H,2,7-8,13-14H2,(H,22,25) |
| InChIKey | ISCGKVNKXSNZBY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|