C16H16N2O4 — CID 154312775
4-[2,3-diamino-4-(2,4-dihydroxyphenyl)buta-1,3-dienyl]benzene-1,3-diol (PubChem CID 154312775) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-[2,3-diamino-4-(2,4-dihydroxyphenyl)buta-1,3-dienyl]benzene-1,3-diol.
| Compound Name | 4-[2,3-diamino-4-(2,4-dihydroxyphenyl)buta-1,3-dienyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 154312775 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[2,3-diamino-4-(2,4-dihydroxyphenyl)buta-1,3-dienyl]benzene-1,3-diol |
| SMILES | NC(=Cc1ccc(O)cc1O)C(N)=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C16H16N2O4/c17-13(5-9-1-3-11(19)7-15(9)21)14(18)6-10-2-4-12(20)8-16(10)22/h1-8,19-22H,17-18H2 |
| InChIKey | BZUWQJLFQWJZGU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|